C23H29N3O2Si — CID 90213723
[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[2-[hydroxy(dimethyl)silyl]-1H-indol-4-yl]methanone (PubChem CID 90213723) has the molecular formula C23H29N3O2Si and a molecular weight of 407.59 g/mol. Its IUPAC name is [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[2-[hydroxy(dimethyl)silyl]-1H-indol-4-yl]methanone.
| Compound Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[2-[hydroxy(dimethyl)silyl]-1H-indol-4-yl]methanone |
|---|---|
| PubChem CID | 90213723 |
| Molecular Formula | C23H29N3O2Si |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[2-[hydroxy(dimethyl)silyl]-1H-indol-4-yl]methanone |
| SMILES | C[Si](C)(O)c1cc2c(C(=O)N3CCC(c4cccc(CN)c4)CC3)cccc2[nH]1 |
| InChI | InChI=1S/C23H29N3O2Si/c1-29(2,28)22-14-20-19(7-4-8-21(20)25-22)23(27)26-11-9-17(10-12-26)18-6-3-5-16(13-18)15-24/h3-8,13-14,17,25,28H,9-12,15,24H2,1-2H3 |
| InChIKey | AEGYBVZOMYMZKS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|