C22H26N2O — CID 74066906
1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-4-phenylbut-3-en-1-one (PubChem CID 74066906) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-4-phenylbut-3-en-1-one.
| Compound Name | 1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-4-phenylbut-3-en-1-one |
|---|---|
| PubChem CID | 74066906 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-4-phenylbut-3-en-1-one |
| SMILES | NCc1cccc(C2CCN(C(=O)CC=Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H26N2O/c23-17-19-9-4-10-21(16-19)20-12-14-24(15-13-20)22(25)11-5-8-18-6-2-1-3-7-18/h1-10,16,20H,11-15,17,23H2 |
| InChIKey | ISBVEEJZNVTUTD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |