C28H28N2O — CID 22266034
[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-[2-(2-methylphenyl)ethynyl]phenyl]methanone (PubChem CID 22266034) has the molecular formula C28H28N2O and a molecular weight of 408.55 g/mol. Its IUPAC name is [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-[2-(2-methylphenyl)ethynyl]phenyl]methanone.
| Compound Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-[2-(2-methylphenyl)ethynyl]phenyl]methanone |
|---|---|
| PubChem CID | 22266034 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-[2-(2-methylphenyl)ethynyl]phenyl]methanone |
| SMILES | Cc1ccccc1C#Cc1cccc(C(=O)N2CCC(c3cccc(CN)c3)CC2)c1 |
| InChI | InChI=1S/C28H28N2O/c1-21-6-2-3-9-24(21)13-12-22-7-4-11-27(18-22)28(31)30-16-14-25(15-17-30)26-10-5-8-23(19-26)20-29/h2-11,18-19,25H,14-17,20,29H2,1H3 |
| InChIKey | LXXQYVVOFYOCPR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|