C26H27ClN4O — CID 22266117
[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-[2-(6-amino-3-pyridinyl)ethynyl]phenyl]methanone;hydrochloride (PubChem CID 22266117) has the molecular formula C26H27ClN4O and a molecular weight of 446.98 g/mol. Its IUPAC name is [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-[2-(6-amino-3-pyridinyl)ethynyl]phenyl]methanone;hydrochloride.
| Compound Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-[2-(6-amino-3-pyridinyl)ethynyl]phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 22266117 |
| Molecular Formula | C26H27ClN4O |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-[2-(6-amino-3-pyridinyl)ethynyl]phenyl]methanone;hydrochloride |
| SMILES | Cl.NCc1cccc(C2CCN(C(=O)c3cccc(C#Cc4ccc(N)nc4)c3)CC2)c1 |
| InChI | InChI=1S/C26H26N4O.ClH/c27-17-21-4-2-5-23(16-21)22-11-13-30(14-12-22)26(31)24-6-1-3-19(15-24)7-8-20-9-10-25(28)29-18-20;/h1-6,9-10,15-16,18,22H,11-14,17,27H2,(H2,28,29);1H |
| InChIKey | GPQTVSALFPGLGU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|