C24H32N2O3 — CID 144547678
(E)-3-(3,4-dihydroxyphenyl)-1-[4-[3-(methylaminomethyl)phenyl]piperidin-1-yl]prop-2-en-1-one;ethane (PubChem CID 144547678) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-1-[4-[3-(methylaminomethyl)phenyl]piperidin-1-yl]prop-2-en-1-one;ethane.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-1-[4-[3-(methylaminomethyl)phenyl]piperidin-1-yl]prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 144547678 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-1-[4-[3-(methylaminomethyl)phenyl]piperidin-1-yl]prop-2-en-1-one;ethane |
| SMILES | CC.CNCc1cccc(C2CCN(C(=O)/C=C/c3ccc(O)c(O)c3)CC2)c1 |
| InChI | InChI=1S/C22H26N2O3.C2H6/c1-23-15-17-3-2-4-19(13-17)18-9-11-24(12-10-18)22(27)8-6-16-5-7-20(25)21(26)14-16;1-2/h2-8,13-14,18,23,25-26H,9-12,15H2,1H3;1-2H3/b8-6+; |
| InChIKey | UIMPASWRPPGTOD-WVLIHFOGSA-N |
| XLogP | 4.26 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|