C22H25N3O3 — CID 67116038
4-[3-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-3-oxoprop-1-enyl]-2-hydroxybenzamide (PubChem CID 67116038) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[3-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-3-oxoprop-1-enyl]-2-hydroxybenzamide.
| Compound Name | 4-[3-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-3-oxoprop-1-enyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 67116038 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-[3-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-3-oxoprop-1-enyl]-2-hydroxybenzamide |
| SMILES | NCc1cccc(C2CCN(C(=O)C=Cc3ccc(C(N)=O)c(O)c3)CC2)c1 |
| InChI | InChI=1S/C22H25N3O3/c23-14-16-2-1-3-18(12-16)17-8-10-25(11-9-17)21(27)7-5-15-4-6-19(22(24)28)20(26)13-15/h1-7,12-13,17,26H,8-11,14,23H2,(H2,24,28) |
| InChIKey | GNBZWALWWUXCKJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|