C20H22N3O3- — CID 86725196
N-[[3-[1-(3-aminobenzoyl)piperidin-4-yl]phenyl]methyl]carbamate (PubChem CID 86725196) has the molecular formula C20H22N3O3- and a molecular weight of 352.41 g/mol. Its IUPAC name is N-[[3-[1-(3-aminobenzoyl)piperidin-4-yl]phenyl]methyl]carbamate.
| Compound Name | N-[[3-[1-(3-aminobenzoyl)piperidin-4-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 86725196 |
| Molecular Formula | C20H22N3O3- |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-[[3-[1-(3-aminobenzoyl)piperidin-4-yl]phenyl]methyl]carbamate |
| SMILES | Nc1cccc(C(=O)N2CCC(c3cccc(CNC(=O)[O-])c3)CC2)c1 |
| InChI | InChI=1S/C20H23N3O3/c21-18-6-2-5-17(12-18)19(24)23-9-7-15(8-10-23)16-4-1-3-14(11-16)13-22-20(25)26/h1-6,11-12,15,22H,7-10,13,21H2,(H,25,26)/p-1 |
| InChIKey | SAPYICCVIRSSFU-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|