C21H17ClN2O3 — CID 43859493
N-(3-chlorophenyl)-4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzamide (PubChem CID 43859493) has the molecular formula C21H17ClN2O3 and a molecular weight of 380.83 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzamide.
| Compound Name | N-(3-chlorophenyl)-4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 43859493 |
| Molecular Formula | C21H17ClN2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-(3-chlorophenyl)-4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(N2C(=O)C3CC=CCC3C2=O)cc1 |
| InChI | InChI=1S/C21H17ClN2O3/c22-14-4-3-5-15(12-14)23-19(25)13-8-10-16(11-9-13)24-20(26)17-6-1-2-7-18(17)21(24)27/h1-5,8-12,17-18H,6-7H2,(H,23,25) |
| InChIKey | MQLUJEVMRPTLJB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|