C22H18N2O5 — CID 1217042
2-[[4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoyl]amino]benzoic acid (PubChem CID 1217042) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[[4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoyl]amino]benzoic acid.
| Compound Name | 2-[[4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1217042 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[[4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccc(N2C(=O)[C@H]3CC=CC[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C22H18N2O5/c25-19(23-18-8-4-3-7-17(18)22(28)29)13-9-11-14(12-10-13)24-20(26)15-5-1-2-6-16(15)21(24)27/h1-4,7-12,15-16H,5-6H2,(H,23,25)(H,28,29)/t15-,16-/m0/s1 |
| InChIKey | XDMHCXLGYRKVNG-HOTGVXAUSA-N |
| XLogP | 3.09 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|