C24H28N2O3 — CID 26008402
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzamide (PubChem CID 26008402) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 26008402 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzamide |
| SMILES | CC(C)Cc1ccc([C@@H](C)NC(=O)c2ccc(CN3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O3/c1-16(2)14-18-4-8-20(9-5-18)17(3)25-24(29)21-10-6-19(7-11-21)15-26-22(27)12-13-23(26)28/h4-11,16-17H,12-15H2,1-3H3,(H,25,29)/t17-/m1/s1 |
| InChIKey | OFAHQYFLRKTXGO-QGZVFWFLSA-N |
| XLogP | 4.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|