C20H21N3O5S — CID 55395964
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[1-(3-sulfamoylphenyl)ethyl]benzamide (PubChem CID 55395964) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[1-(3-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[1-(3-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55395964 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[1-(3-sulfamoylphenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(CN2C(=O)CCC2=O)cc1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H21N3O5S/c1-13(16-3-2-4-17(11-16)29(21,27)28)22-20(26)15-7-5-14(6-8-15)12-23-18(24)9-10-19(23)25/h2-8,11,13H,9-10,12H2,1H3,(H,22,26)(H2,21,27,28) |
| InChIKey | CGBFEBKJXOAFMS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|