C37H33N3O8 — CID 159981063
[4-[4-(cyclopropanecarbonylamino)phenyl]phenyl] (2,5-dioxopyrrolidin-1-yl) carbonate;N-cyclopropyl-4-(4-hydroxyphenyl)benzamide (PubChem CID 159981063) has the molecular formula C37H33N3O8 and a molecular weight of 647.68 g/mol. Its IUPAC name is [4-[4-(cyclopropanecarbonylamino)phenyl]phenyl] (2,5-dioxopyrrolidin-1-yl) carbonate;N-cyclopropyl-4-(4-hydroxyphenyl)benzamide.
| Compound Name | [4-[4-(cyclopropanecarbonylamino)phenyl]phenyl] (2,5-dioxopyrrolidin-1-yl) carbonate;N-cyclopropyl-4-(4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 159981063 |
| Molecular Formula | C37H33N3O8 |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | [4-[4-(cyclopropanecarbonylamino)phenyl]phenyl] (2,5-dioxopyrrolidin-1-yl) carbonate;N-cyclopropyl-4-(4-hydroxyphenyl)benzamide |
| SMILES | O=C(NC1CC1)c1ccc(-c2ccc(O)cc2)cc1.O=C(Oc1ccc(-c2ccc(NC(=O)C3CC3)cc2)cc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C21H18N2O6.C16H15NO2/c24-18-11-12-19(25)23(18)29-21(27)28-17-9-5-14(6-10-17)13-3-7-16(8-4-13)22-20(26)15-1-2-15;18-15-9-5-12(6-10-15)11-1-3-13(4-2-11)16(19)17-14-7-8-14/h3-10,15H,1-2,11-12H2,(H,22,26);1-6,9-10,14,18H,7-8H2,(H,17,19) |
| InChIKey | OFTWCOVKEXMIJE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|