C16H30N2O6 — CID 165397730
(2,5-dioxopyrrolidin-1-yl) 2-[4-(1-amino-2-methylpropan-2-yl)oxybutan-2-yloxy]acetate;ethane (PubChem CID 165397730) has the molecular formula C16H30N2O6 and a molecular weight of 346.42 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[4-(1-amino-2-methylpropan-2-yl)oxybutan-2-yloxy]acetate;ethane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-(1-amino-2-methylpropan-2-yl)oxybutan-2-yloxy]acetate;ethane |
|---|---|
| PubChem CID | 165397730 |
| Molecular Formula | C16H30N2O6 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-(1-amino-2-methylpropan-2-yl)oxybutan-2-yloxy]acetate;ethane |
| SMILES | CC.CC(CCOC(C)(C)CN)OCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H24N2O6.C2H6/c1-10(6-7-21-14(2,3)9-15)20-8-13(19)22-16-11(17)4-5-12(16)18;1-2/h10H,4-9,15H2,1-3H3;1-2H3 |
| InChIKey | KSZDCSLTKLPNOL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|