C17H20N2O9 — CID 76674165
(2,5-dioxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-2-methyl-3-oxopropoxy]-2-methylbut-2-enoate (PubChem CID 76674165) has the molecular formula C17H20N2O9 and a molecular weight of 396.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-2-methyl-3-oxopropoxy]-2-methylbut-2-enoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-2-methyl-3-oxopropoxy]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 76674165 |
| Molecular Formula | C17H20N2O9 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-2-methyl-3-oxopropoxy]-2-methylbut-2-enoate |
| SMILES | CC(=CCOCC(C)C(=O)ON1C(=O)CCC1=O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H20N2O9/c1-10(16(24)27-18-12(20)3-4-13(18)21)7-8-26-9-11(2)17(25)28-19-14(22)5-6-15(19)23/h7,11H,3-6,8-9H2,1-2H3 |
| InChIKey | SWQYYGVCOGIMNE-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|