C9H11IN2O2 — CID 89094308
(2S)-2-hydrazinyl-3-(4-hydroxyphenyl)propanoyl iodide (PubChem CID 89094308) has the molecular formula C9H11IN2O2 and a molecular weight of 306.10 g/mol. Its IUPAC name is (2S)-2-hydrazinyl-3-(4-hydroxyphenyl)propanoyl iodide.
| Compound Name | (2S)-2-hydrazinyl-3-(4-hydroxyphenyl)propanoyl iodide |
|---|---|
| PubChem CID | 89094308 |
| Molecular Formula | C9H11IN2O2 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | (2S)-2-hydrazinyl-3-(4-hydroxyphenyl)propanoyl iodide |
| SMILES | NN[C@@H](Cc1ccc(O)cc1)C(=O)I |
| InChI | InChI=1S/C9H11IN2O2/c10-9(14)8(12-11)5-6-1-3-7(13)4-2-6/h1-4,8,12-13H,5,11H2/t8-/m0/s1 |
| InChIKey | GFYLZDXMYAGGEC-QMMMGPOBSA-N |
| XLogP | 0.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|