C9H13N3O2 — CID 144742434
2-hydrazinyl-3-(4-hydroxyphenyl)propanamide (PubChem CID 144742434) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-hydrazinyl-3-(4-hydroxyphenyl)propanamide.
| Compound Name | 2-hydrazinyl-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 144742434 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-hydrazinyl-3-(4-hydroxyphenyl)propanamide |
| SMILES | NNC(Cc1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C9H13N3O2/c10-9(14)8(12-11)5-6-1-3-7(13)4-2-6/h1-4,8,12-13H,5,11H2,(H2,10,14) |
| InChIKey | IYLWQKBZFRREAK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|