C12H14N2O4 — CID 151559581
[[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino] prop-2-enoate (PubChem CID 151559581) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is [[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino] prop-2-enoate.
| Compound Name | [[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino] prop-2-enoate |
|---|---|
| PubChem CID | 151559581 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino] prop-2-enoate |
| SMILES | C=CC(=O)ON[C@@H](Cc1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C12H14N2O4/c1-2-11(16)18-14-10(12(13)17)7-8-3-5-9(15)6-4-8/h2-6,10,14-15H,1,7H2,(H2,13,17)/t10-/m0/s1 |
| InChIKey | QCENJKNUCJIXPG-JTQLQIEISA-N |
| XLogP | 0.02 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|