C13H23N3O3 — CID 142338816
ethane;2-[2-(hydroxyamino)ethylamino]-3-(4-hydroxyphenyl)propanamide (PubChem CID 142338816) has the molecular formula C13H23N3O3 and a molecular weight of 269.35 g/mol. Its IUPAC name is ethane;2-[2-(hydroxyamino)ethylamino]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | ethane;2-[2-(hydroxyamino)ethylamino]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 142338816 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | ethane;2-[2-(hydroxyamino)ethylamino]-3-(4-hydroxyphenyl)propanamide |
| SMILES | CC.NC(=O)C(Cc1ccc(O)cc1)NCCNO |
| InChI | InChI=1S/C11H17N3O3.C2H6/c12-11(16)10(13-5-6-14-17)7-8-1-3-9(15)4-2-8;1-2/h1-4,10,13-15,17H,5-7H2,(H2,12,16);1-2H3 |
| InChIKey | KFFOYJHYKTYCKD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|