C16H32N6O3 — CID 142338785
2-[2-(hydroxyamino)ethylamino]-3-(4-hydroxyphenyl)propanamide;methanimidamide;N-methylpropan-1-amine (PubChem CID 142338785) has the molecular formula C16H32N6O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[2-(hydroxyamino)ethylamino]-3-(4-hydroxyphenyl)propanamide;methanimidamide;N-methylpropan-1-amine.
| Compound Name | 2-[2-(hydroxyamino)ethylamino]-3-(4-hydroxyphenyl)propanamide;methanimidamide;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 142338785 |
| Molecular Formula | C16H32N6O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 2-[2-(hydroxyamino)ethylamino]-3-(4-hydroxyphenyl)propanamide;methanimidamide;N-methylpropan-1-amine |
| SMILES | CCCNC.NC(=O)C(Cc1ccc(O)cc1)NCCNO.[H]/N=C/N |
| InChI | InChI=1S/C11H17N3O3.C4H11N.CH4N2/c12-11(16)10(13-5-6-14-17)7-8-1-3-9(15)4-2-8;1-3-4-5-2;2-1-3/h1-4,10,13-15,17H,5-7H2,(H2,12,16);5H,3-4H2,1-2H3;1H,(H3,2,3) |
| InChIKey | PMLBUKQLQDRIJD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 169.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|