C16H26N4O3 — CID 118085271
(3S)-3-amino-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-(methylamino)hexanamide (PubChem CID 118085271) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is (3S)-3-amino-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-(methylamino)hexanamide.
| Compound Name | (3S)-3-amino-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-(methylamino)hexanamide |
|---|---|
| PubChem CID | 118085271 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3S)-3-amino-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-(methylamino)hexanamide |
| SMILES | CNCCC[C@H](N)CC(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C16H26N4O3/c1-19-8-2-3-12(17)10-15(22)20-14(16(18)23)9-11-4-6-13(21)7-5-11/h4-7,12,14,19,21H,2-3,8-10,17H2,1H3,(H2,18,23)(H,20,22)/t12-,14-/m0/s1 |
| InChIKey | BTSOAYVMXRPJEG-JSGCOSHPSA-N |
| XLogP | -0.38 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|