C33H45N3O9 — CID 158211543
(2,5-dioxopyrrolidin-1-yl) propanoate;4-(4-hydroxyphenyl)-3-(methylamino)butan-2-one;[4-[2-(methylamino)-3-oxobutyl]phenyl] butanoate (PubChem CID 158211543) has the molecular formula C33H45N3O9 and a molecular weight of 627.74 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) propanoate;4-(4-hydroxyphenyl)-3-(methylamino)butan-2-one;[4-[2-(methylamino)-3-oxobutyl]phenyl] butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) propanoate;4-(4-hydroxyphenyl)-3-(methylamino)butan-2-one;[4-[2-(methylamino)-3-oxobutyl]phenyl] butanoate |
|---|---|
| PubChem CID | 158211543 |
| Molecular Formula | C33H45N3O9 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) propanoate;4-(4-hydroxyphenyl)-3-(methylamino)butan-2-one;[4-[2-(methylamino)-3-oxobutyl]phenyl] butanoate |
| SMILES | CCC(=O)ON1C(=O)CCC1=O.CCCC(=O)Oc1ccc(CC(NC)C(C)=O)cc1.CNC(Cc1ccc(O)cc1)C(C)=O |
| InChI | InChI=1S/C15H21NO3.C11H15NO2.C7H9NO4/c1-4-5-15(18)19-13-8-6-12(7-9-13)10-14(16-3)11(2)17;1-8(13)11(12-2)7-9-3-5-10(14)6-4-9;1-2-7(11)12-8-5(9)3-4-6(8)10/h6-9,14,16H,4-5,10H2,1-3H3;3-6,11-12,14H,7H2,1-2H3;2-4H2,1H3 |
| InChIKey | GCDHCWHWCWFFAD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|