C23H28O13 — CID 154945299
4-[3-(4-carboxyphenoxy)propoxy]benzoic acid;2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 154945299) has the molecular formula C23H28O13 and a molecular weight of 512.46 g/mol. Its IUPAC name is 4-[3-(4-carboxyphenoxy)propoxy]benzoic acid;2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | 4-[3-(4-carboxyphenoxy)propoxy]benzoic acid;2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 154945299 |
| Molecular Formula | C23H28O13 |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 4-[3-(4-carboxyphenoxy)propoxy]benzoic acid;2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)CO.O=C(O)c1ccc(OCCCOc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H16O6.C6H12O7/c18-16(19)12-2-6-14(7-3-12)22-10-1-11-23-15-8-4-13(5-9-15)17(20)21;7-1-2(8)3(9)4(10)5(11)6(12)13/h2-9H,1,10-11H2,(H,18,19)(H,20,21);2-5,7-11H,1H2,(H,12,13) |
| InChIKey | HOXZLYAIZGQZSJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 231.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|