C16H24ClNO7 — CID 108790085
3-(4-chlorophenoxy)-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)propanamide (PubChem CID 108790085) has the molecular formula C16H24ClNO7 and a molecular weight of 377.82 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)propanamide.
| Compound Name | 3-(4-chlorophenoxy)-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)propanamide |
|---|---|
| PubChem CID | 108790085 |
| Molecular Formula | C16H24ClNO7 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-(4-chlorophenoxy)-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)propanamide |
| SMILES | CN(CC(O)C(O)C(O)C(O)CO)C(=O)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClNO7/c1-18(8-12(20)15(23)16(24)13(21)9-19)14(22)6-7-25-11-4-2-10(17)3-5-11/h2-5,12-13,15-16,19-21,23-24H,6-9H2,1H3 |
| InChIKey | AJWAHJOMHSUFRR-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |