C16H25NO7 — CID 108795484
N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)-3-phenoxypropanamide (PubChem CID 108795484) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)-3-phenoxypropanamide.
| Compound Name | N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)-3-phenoxypropanamide |
|---|---|
| PubChem CID | 108795484 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)-3-phenoxypropanamide |
| SMILES | CN(CC(O)C(O)C(O)C(O)CO)C(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C16H25NO7/c1-17(9-12(19)15(22)16(23)13(20)10-18)14(21)7-8-24-11-5-3-2-4-6-11/h2-6,12-13,15-16,18-20,22-23H,7-10H2,1H3 |
| InChIKey | AVZLCMYXKSJAQI-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |