C15H23NO7S — CID 108796375
N-methyl-4-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)-4-thiophen-2-ylbutanamide (PubChem CID 108796375) has the molecular formula C15H23NO7S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-methyl-4-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-methyl-4-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 108796375 |
| Molecular Formula | C15H23NO7S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-methyl-4-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)-4-thiophen-2-ylbutanamide |
| SMILES | CN(CC(O)C(O)C(O)C(O)CO)C(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C15H23NO7S/c1-16(7-10(19)14(22)15(23)11(20)8-17)13(21)5-4-9(18)12-3-2-6-24-12/h2-3,6,10-11,14-15,17,19-20,22-23H,4-5,7-8H2,1H3 |
| InChIKey | SUQIZJPIPUFVCY-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |