C15H18N2O3S — CID 60609811
N-(2-cyanoethyl)-N-methyl-4,7-dioxo-7-thiophen-2-ylheptanamide (PubChem CID 60609811) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-methyl-4,7-dioxo-7-thiophen-2-ylheptanamide.
| Compound Name | N-(2-cyanoethyl)-N-methyl-4,7-dioxo-7-thiophen-2-ylheptanamide |
|---|---|
| PubChem CID | 60609811 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-(2-cyanoethyl)-N-methyl-4,7-dioxo-7-thiophen-2-ylheptanamide |
| SMILES | CN(CCC#N)C(=O)CCC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C15H18N2O3S/c1-17(10-3-9-16)15(20)8-6-12(18)5-7-13(19)14-4-2-11-21-14/h2,4,11H,3,5-8,10H2,1H3 |
| InChIKey | SWCFSKJKMCRKBD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |