C24H30O8 — CID 169093067
1,3-bis(4-ethylphenyl)-2-hydroxy-2-[(1R,2R,3R,4S)-1,2,3,4,5-pentahydroxypentyl]propane-1,3-dione (PubChem CID 169093067) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is 1,3-bis(4-ethylphenyl)-2-hydroxy-2-[(1R,2R,3R,4S)-1,2,3,4,5-pentahydroxypentyl]propane-1,3-dione.
| Compound Name | 1,3-bis(4-ethylphenyl)-2-hydroxy-2-[(1R,2R,3R,4S)-1,2,3,4,5-pentahydroxypentyl]propane-1,3-dione |
|---|---|
| PubChem CID | 169093067 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1,3-bis(4-ethylphenyl)-2-hydroxy-2-[(1R,2R,3R,4S)-1,2,3,4,5-pentahydroxypentyl]propane-1,3-dione |
| SMILES | CCc1ccc(C(=O)C(O)(C(=O)c2ccc(CC)cc2)[C@H](O)[C@H](O)[C@H](O)[C@@H](O)CO)cc1 |
| InChI | InChI=1S/C24H30O8/c1-3-14-5-9-16(10-6-14)21(29)24(32,23(31)20(28)19(27)18(26)13-25)22(30)17-11-7-15(4-2)8-12-17/h5-12,18-20,23,25-28,31-32H,3-4,13H2,1-2H3/t18-,19+,20+,23+/m0/s1 |
| InChIKey | QLAVRYZBWPKMAO-DZCCDHAISA-N |
| XLogP | 0.04 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|