C23H45NO16 — CID 167299431
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide (PubChem CID 167299431) has the molecular formula C23H45NO16 and a molecular weight of 591.60 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide |
|---|---|
| PubChem CID | 167299431 |
| Molecular Formula | C23H45NO16 |
| Molecular Weight | 591.60 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide |
| SMILES | O=CCCOCCOCCOCCOCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C23H45NO16/c25-3-1-4-37-6-8-39-10-11-40-9-7-38-5-2-24(12-15(28)18(31)19(32)16(29)13-26)23(36)22(35)21(34)20(33)17(30)14-27/h3,15-22,26-35H,1-2,4-14H2/t15-,16+,17+,18+,19+,20+,21-,22+/m0/s1 |
| InChIKey | UUDRLWLMORKOCE-QFSSDPKNSA-N |
| XLogP | -6.66 |
| TPSA | 276.60 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.60 |
| LogP ≤ 5 | -6.66 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|