C21H44N2O14 — CID 171850510
3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N,N-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide (PubChem CID 171850510) has the molecular formula C21H44N2O14 and a molecular weight of 548.58 g/mol. Its IUPAC name is 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N,N-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide.
| Compound Name | 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N,N-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
|---|---|
| PubChem CID | 171850510 |
| Molecular Formula | C21H44N2O14 |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N,N-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
| SMILES | NCCOCCOCCOCCC(=O)N(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C21H44N2O14/c22-2-4-36-6-8-37-7-5-35-3-1-17(30)23(9-13(26)18(31)20(33)15(28)11-24)10-14(27)19(32)21(34)16(29)12-25/h13-16,18-21,24-29,31-34H,1-12,22H2/t13-,14-,15+,16+,18+,19+,20+,21+/m0/s1 |
| InChIKey | UXGONAFFKHPVBQ-GECHXAPTSA-N |
| XLogP | -6.91 |
| TPSA | 276.32 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | -6.91 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|