C30H42N2O8 — CID 170338773
2-[2-[4-[2-[hexyl(2,3,4,5,6-pentahydroxyhexyl)amino]ethyl]phenoxy]ethyl]isoindole-1,3-dione (PubChem CID 170338773) has the molecular formula C30H42N2O8 and a molecular weight of 558.67 g/mol. Its IUPAC name is 2-[2-[4-[2-[hexyl(2,3,4,5,6-pentahydroxyhexyl)amino]ethyl]phenoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[2-[hexyl(2,3,4,5,6-pentahydroxyhexyl)amino]ethyl]phenoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170338773 |
| Molecular Formula | C30H42N2O8 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 2-[2-[4-[2-[hexyl(2,3,4,5,6-pentahydroxyhexyl)amino]ethyl]phenoxy]ethyl]isoindole-1,3-dione |
| SMILES | CCCCCCN(CCc1ccc(OCCN2C(=O)c3ccccc3C2=O)cc1)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C30H42N2O8/c1-2-3-4-7-15-31(19-25(34)27(36)28(37)26(35)20-33)16-14-21-10-12-22(13-11-21)40-18-17-32-29(38)23-8-5-6-9-24(23)30(32)39/h5-6,8-13,25-28,33-37H,2-4,7,14-20H2,1H3 |
| InChIKey | FOJXNJCWFDTGIB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|