C33H54N2O12S — CID 170085746
4-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]butyl 3-[2-(4-pentylphenyl)-1,3-thiazol-5-yl]propanoate (PubChem CID 170085746) has the molecular formula C33H54N2O12S and a molecular weight of 702.86 g/mol. Its IUPAC name is 4-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]butyl 3-[2-(4-pentylphenyl)-1,3-thiazol-5-yl]propanoate.
| Compound Name | 4-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]butyl 3-[2-(4-pentylphenyl)-1,3-thiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 170085746 |
| Molecular Formula | C33H54N2O12S |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.34 |
| IUPAC Name | 4-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]butyl 3-[2-(4-pentylphenyl)-1,3-thiazol-5-yl]propanoate |
| SMILES | CCCCCc1ccc(-c2ncc(CCC(=O)OCCCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)s2)cc1 |
| InChI | InChI=1S/C33H54N2O12S/c1-2-3-4-7-21-8-10-22(11-9-21)33-34-16-23(48-33)12-13-28(42)47-15-6-5-14-35(17-24(38)29(43)31(45)26(40)19-36)18-25(39)30(44)32(46)27(41)20-37/h8-11,16,24-27,29-32,36-41,43-46H,2-7,12-15,17-20H2,1H3/t24-,25-,26+,27+,29+,30+,31+,32+/m0/s1 |
| InChIKey | HCFKOBYICKCONW-WSTNYBAFSA-N |
| XLogP | -1.03 |
| TPSA | 244.73 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|