C35H56N2O11 — CID 169109847
3-[4-[4-(4-aminobutyl)phenyl]phenyl]propyl 3-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-[(2R,3R,4S,5R)-2,4,5,6-tetrahydroxy-3-methylhexyl]amino]propanoate (PubChem CID 169109847) has the molecular formula C35H56N2O11 and a molecular weight of 680.84 g/mol. Its IUPAC name is 3-[4-[4-(4-aminobutyl)phenyl]phenyl]propyl 3-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-[(2R,3R,4S,5R)-2,4,5,6-tetrahydroxy-3-methylhexyl]amino]propanoate.
| Compound Name | 3-[4-[4-(4-aminobutyl)phenyl]phenyl]propyl 3-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-[(2R,3R,4S,5R)-2,4,5,6-tetrahydroxy-3-methylhexyl]amino]propanoate |
|---|---|
| PubChem CID | 169109847 |
| Molecular Formula | C35H56N2O11 |
| Molecular Weight | 680.84 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | 3-[4-[4-(4-aminobutyl)phenyl]phenyl]propyl 3-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-[(2R,3R,4S,5R)-2,4,5,6-tetrahydroxy-3-methylhexyl]amino]propanoate |
| SMILES | C[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)CN(CCC(=O)OCCCc1ccc(-c2ccc(CCCCN)cc2)cc1)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C35H56N2O11/c1-23(33(45)30(42)21-38)28(40)19-37(20-29(41)34(46)35(47)31(43)22-39)17-15-32(44)48-18-4-6-25-9-13-27(14-10-25)26-11-7-24(8-12-26)5-2-3-16-36/h7-14,23,28-31,33-35,38-43,45-47H,2-6,15-22,36H2,1H3/t23-,28+,29+,30-,31-,33+,34-,35-/m1/s1 |
| InChIKey | GZAHCLZNYRTYOM-BJCDVFBSSA-N |
| XLogP | -1.05 |
| TPSA | 237.63 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.84 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|