C15H34N2O10 — CID 139581095
6-[3-aminopropyl(2,3,4,5,6-pentahydroxyhexyl)amino]hexane-1,2,3,4,5-pentol (PubChem CID 139581095) has the molecular formula C15H34N2O10 and a molecular weight of 402.44 g/mol. Its IUPAC name is 6-[3-aminopropyl(2,3,4,5,6-pentahydroxyhexyl)amino]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[3-aminopropyl(2,3,4,5,6-pentahydroxyhexyl)amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 139581095 |
| Molecular Formula | C15H34N2O10 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 6-[3-aminopropyl(2,3,4,5,6-pentahydroxyhexyl)amino]hexane-1,2,3,4,5-pentol |
| SMILES | NCCCN(CC(O)C(O)C(O)C(O)CO)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C15H34N2O10/c16-2-1-3-17(4-8(20)12(24)14(26)10(22)6-18)5-9(21)13(25)15(27)11(23)7-19/h8-15,18-27H,1-7,16H2 |
| InChIKey | BBLDUGYKLRVBFD-UHFFFAOYSA-N |
| XLogP | -6.49 |
| TPSA | 231.56 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | -6.49 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |