C13H30N2O4 — CID 118385579
(2R,3R,4S)-5-[2-aminoethyl(hexyl)amino]pentane-1,2,3,4-tetrol (PubChem CID 118385579) has the molecular formula C13H30N2O4 and a molecular weight of 278.39 g/mol. Its IUPAC name is (2R,3R,4S)-5-[2-aminoethyl(hexyl)amino]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4S)-5-[2-aminoethyl(hexyl)amino]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 118385579 |
| Molecular Formula | C13H30N2O4 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (2R,3R,4S)-5-[2-aminoethyl(hexyl)amino]pentane-1,2,3,4-tetrol |
| SMILES | CCCCCCN(CCN)C[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H30N2O4/c1-2-3-4-5-7-15(8-6-14)9-11(17)13(19)12(18)10-16/h11-13,16-19H,2-10,14H2,1H3/t11-,12+,13+/m0/s1 |
| InChIKey | FZPGMQKDEKUHSB-YNEHKIRRSA-N |
| XLogP | -1.10 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|