C42H60N2O7 — CID 169109743
methyl (2S)-2-[3-[4-(4-pentylphenyl)phenyl]propanoylamino]-6-[3-phenylpropyl-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]amino]hexanoate (PubChem CID 169109743) has the molecular formula C42H60N2O7 and a molecular weight of 704.95 g/mol. Its IUPAC name is methyl (2S)-2-[3-[4-(4-pentylphenyl)phenyl]propanoylamino]-6-[3-phenylpropyl-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]amino]hexanoate.
| Compound Name | methyl (2S)-2-[3-[4-(4-pentylphenyl)phenyl]propanoylamino]-6-[3-phenylpropyl-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]amino]hexanoate |
|---|---|
| PubChem CID | 169109743 |
| Molecular Formula | C42H60N2O7 |
| Molecular Weight | 704.95 g/mol |
| Exact Mass | 704.44 |
| IUPAC Name | methyl (2S)-2-[3-[4-(4-pentylphenyl)phenyl]propanoylamino]-6-[3-phenylpropyl-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]amino]hexanoate |
| SMILES | CCCCCc1ccc(-c2ccc(CCC(=O)N[C@@H](CCCCN(CCCc3ccccc3)C[C@H](O)[C@@H](O)[C@H](O)CCO)C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C42H60N2O7/c1-3-4-6-12-33-17-22-35(23-18-33)36-24-19-34(20-25-36)21-26-40(48)43-37(42(50)51-2)16-9-10-28-44(29-11-15-32-13-7-5-8-14-32)31-39(47)41(49)38(46)27-30-45/h5,7-8,13-14,17-20,22-25,37-39,41,45-47,49H,3-4,6,9-12,15-16,21,26-31H2,1-2H3,(H,43,48)/t37-,38+,39-,41-/m0/s1 |
| InChIKey | PLAMAFMPEJFBBJ-WKUWDWPYSA-N |
| XLogP | 5.25 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.95 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|