C36H46N2O4 — CID 101014992
6-[benzyl-(4-phenylbenzoyl)amino]-2-(decanoylamino)hexanoic acid (PubChem CID 101014992) has the molecular formula C36H46N2O4 and a molecular weight of 570.77 g/mol. Its IUPAC name is 6-[benzyl-(4-phenylbenzoyl)amino]-2-(decanoylamino)hexanoic acid.
| Compound Name | 6-[benzyl-(4-phenylbenzoyl)amino]-2-(decanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 101014992 |
| Molecular Formula | C36H46N2O4 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.35 |
| IUPAC Name | 6-[benzyl-(4-phenylbenzoyl)amino]-2-(decanoylamino)hexanoic acid |
| SMILES | CCCCCCCCCC(=O)NC(CCCCN(Cc1ccccc1)C(=O)c1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C36H46N2O4/c1-2-3-4-5-6-7-14-22-34(39)37-33(36(41)42)21-15-16-27-38(28-29-17-10-8-11-18-29)35(40)32-25-23-31(24-26-32)30-19-12-9-13-20-30/h8-13,17-20,23-26,33H,2-7,14-16,21-22,27-28H2,1H3,(H,37,39)(H,41,42) |
| InChIKey | PFBJKMPQHSNQFU-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|