C25H32N2O3 — CID 101015025
6-[benzyl(prop-2-enyl)amino]-2-(3-phenylpropanoylamino)hexanoic acid (PubChem CID 101015025) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 6-[benzyl(prop-2-enyl)amino]-2-(3-phenylpropanoylamino)hexanoic acid.
| Compound Name | 6-[benzyl(prop-2-enyl)amino]-2-(3-phenylpropanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 101015025 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 6-[benzyl(prop-2-enyl)amino]-2-(3-phenylpropanoylamino)hexanoic acid |
| SMILES | C=CCN(CCCCC(NC(=O)CCc1ccccc1)C(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C25H32N2O3/c1-2-18-27(20-22-13-7-4-8-14-22)19-10-9-15-23(25(29)30)26-24(28)17-16-21-11-5-3-6-12-21/h2-8,11-14,23H,1,9-10,15-20H2,(H,26,28)(H,29,30) |
| InChIKey | VJBBFBDXCOBDMU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|