C31H37NO4 — CID 173433597
acetic acid;2-(2-phenylphenyl)-5-[3-phenylpropyl(prop-2-enyl)amino]pentanoic acid (PubChem CID 173433597) has the molecular formula C31H37NO4 and a molecular weight of 487.64 g/mol. Its IUPAC name is acetic acid;2-(2-phenylphenyl)-5-[3-phenylpropyl(prop-2-enyl)amino]pentanoic acid.
| Compound Name | acetic acid;2-(2-phenylphenyl)-5-[3-phenylpropyl(prop-2-enyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 173433597 |
| Molecular Formula | C31H37NO4 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | acetic acid;2-(2-phenylphenyl)-5-[3-phenylpropyl(prop-2-enyl)amino]pentanoic acid |
| SMILES | C=CCN(CCCc1ccccc1)CCCC(C(=O)O)c1ccccc1-c1ccccc1.CC(=O)O |
| InChI | InChI=1S/C29H33NO2.C2H4O2/c1-2-21-30(22-11-15-24-13-5-3-6-14-24)23-12-20-28(29(31)32)27-19-10-9-18-26(27)25-16-7-4-8-17-25;1-2(3)4/h2-10,13-14,16-19,28H,1,11-12,15,20-23H2,(H,31,32);1H3,(H,3,4) |
| InChIKey | RPLUNUZUJSQFOZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|