C31H37BrN2O — CID 57015083
2-(4-bromo-2-phenylphenyl)-5-[hex-3-enyl(2-phenylethyl)amino]pentanamide (PubChem CID 57015083) has the molecular formula C31H37BrN2O and a molecular weight of 533.55 g/mol. Its IUPAC name is 2-(4-bromo-2-phenylphenyl)-5-[hex-3-enyl(2-phenylethyl)amino]pentanamide.
| Compound Name | 2-(4-bromo-2-phenylphenyl)-5-[hex-3-enyl(2-phenylethyl)amino]pentanamide |
|---|---|
| PubChem CID | 57015083 |
| Molecular Formula | C31H37BrN2O |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 2-(4-bromo-2-phenylphenyl)-5-[hex-3-enyl(2-phenylethyl)amino]pentanamide |
| SMILES | CCC=CCCN(CCCC(C(N)=O)c1ccc(Br)cc1-c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C31H37BrN2O/c1-2-3-4-11-21-34(23-20-25-13-7-5-8-14-25)22-12-17-29(31(33)35)28-19-18-27(32)24-30(28)26-15-9-6-10-16-26/h3-10,13-16,18-19,24,29H,2,11-12,17,20-23H2,1H3,(H2,33,35) |
| InChIKey | ZZLWPWTXDDLGFM-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|