C19H26BrN3O2 — CID 70412302
1-[2-[ethyl(2-phenylethyl)amino]ethyl]-1-(4-hydroxyphenyl)urea;hydrobromide (PubChem CID 70412302) has the molecular formula C19H26BrN3O2 and a molecular weight of 408.34 g/mol. Its IUPAC name is 1-[2-[ethyl(2-phenylethyl)amino]ethyl]-1-(4-hydroxyphenyl)urea;hydrobromide.
| Compound Name | 1-[2-[ethyl(2-phenylethyl)amino]ethyl]-1-(4-hydroxyphenyl)urea;hydrobromide |
|---|---|
| PubChem CID | 70412302 |
| Molecular Formula | C19H26BrN3O2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 1-[2-[ethyl(2-phenylethyl)amino]ethyl]-1-(4-hydroxyphenyl)urea;hydrobromide |
| SMILES | Br.CCN(CCc1ccccc1)CCN(C(N)=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H25N3O2.BrH/c1-2-21(13-12-16-6-4-3-5-7-16)14-15-22(19(20)24)17-8-10-18(23)11-9-17;/h3-11,23H,2,12-15H2,1H3,(H2,20,24);1H |
| InChIKey | SFALUQJSUQWBMR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |