C23H35N3O2S — CID 126719487
tert-butyl N-[[2-[4-[4-(diethylamino)butyl]phenyl]-1,3-thiazol-5-yl]methyl]carbamate (PubChem CID 126719487) has the molecular formula C23H35N3O2S and a molecular weight of 417.62 g/mol. Its IUPAC name is tert-butyl N-[[2-[4-[4-(diethylamino)butyl]phenyl]-1,3-thiazol-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[4-[4-(diethylamino)butyl]phenyl]-1,3-thiazol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 126719487 |
| Molecular Formula | C23H35N3O2S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | tert-butyl N-[[2-[4-[4-(diethylamino)butyl]phenyl]-1,3-thiazol-5-yl]methyl]carbamate |
| SMILES | CCN(CC)CCCCc1ccc(-c2ncc(CNC(=O)OC(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C23H35N3O2S/c1-6-26(7-2)15-9-8-10-18-11-13-19(14-12-18)21-24-16-20(29-21)17-25-22(27)28-23(3,4)5/h11-14,16H,6-10,15,17H2,1-5H3,(H,25,27) |
| InChIKey | YXPIOXIQZZHTBN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|