C17H23N3O2S — CID 126719795
tert-butyl N-[[2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl]carbamate (PubChem CID 126719795) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is tert-butyl N-[[2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 126719795 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | tert-butyl N-[[2-[4-(dimethylamino)phenyl]-1,3-thiazol-5-yl]methyl]carbamate |
| SMILES | CN(C)c1ccc(-c2ncc(CNC(=O)OC(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-17(2,3)22-16(21)19-11-14-10-18-15(23-14)12-6-8-13(9-7-12)20(4)5/h6-10H,11H2,1-5H3,(H,19,21) |
| InChIKey | JHHPHKAWSFTWRK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|