C19H27N3O3S — CID 126719862
tert-butyl N-[[2-[4-(4-aminobutoxy)phenyl]-1,3-thiazol-5-yl]methyl]carbamate (PubChem CID 126719862) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is tert-butyl N-[[2-[4-(4-aminobutoxy)phenyl]-1,3-thiazol-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[4-(4-aminobutoxy)phenyl]-1,3-thiazol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 126719862 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | tert-butyl N-[[2-[4-(4-aminobutoxy)phenyl]-1,3-thiazol-5-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cnc(-c2ccc(OCCCCN)cc2)s1 |
| InChI | InChI=1S/C19H27N3O3S/c1-19(2,3)25-18(23)22-13-16-12-21-17(26-16)14-6-8-15(9-7-14)24-11-5-4-10-20/h6-9,12H,4-5,10-11,13,20H2,1-3H3,(H,22,23) |
| InChIKey | BFFZYZRGGDZMNB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|