C16H24N4O3S — CID 126719396
tert-butyl N-[[2-[4-(4-hydroxybutyl)pyrazol-1-yl]-1,3-thiazol-5-yl]methyl]carbamate (PubChem CID 126719396) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is tert-butyl N-[[2-[4-(4-hydroxybutyl)pyrazol-1-yl]-1,3-thiazol-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[4-(4-hydroxybutyl)pyrazol-1-yl]-1,3-thiazol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 126719396 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | tert-butyl N-[[2-[4-(4-hydroxybutyl)pyrazol-1-yl]-1,3-thiazol-5-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cnc(-n2cc(CCCCO)cn2)s1 |
| InChI | InChI=1S/C16H24N4O3S/c1-16(2,3)23-15(22)18-10-13-9-17-14(24-13)20-11-12(8-19-20)6-4-5-7-21/h8-9,11,21H,4-7,10H2,1-3H3,(H,18,22) |
| InChIKey | HMRBDXDNZNIKRE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|