C12H20N2O3 — CID 122240642
tert-butyl 2-[4-(3-hydroxypropyl)pyrazol-1-yl]acetate (PubChem CID 122240642) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is tert-butyl 2-[4-(3-hydroxypropyl)pyrazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-(3-hydroxypropyl)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 122240642 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | tert-butyl 2-[4-(3-hydroxypropyl)pyrazol-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1cc(CCCO)cn1 |
| InChI | InChI=1S/C12H20N2O3/c1-12(2,3)17-11(16)9-14-8-10(7-13-14)5-4-6-15/h7-8,15H,4-6,9H2,1-3H3 |
| InChIKey | FNXGPQNSJNPJII-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |