C23H37NO11S — CID 137448935
(2R,5S)-8-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-[2-[3-(sulfanylmethyl)phenoxy]ethyl]amino]octa-3,6-diene-1,2,3,5,6-pentol (PubChem CID 137448935) has the molecular formula C23H37NO11S and a molecular weight of 535.61 g/mol. Its IUPAC name is (2R,5S)-8-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-[2-[3-(sulfanylmethyl)phenoxy]ethyl]amino]octa-3,6-diene-1,2,3,5,6-pentol.
| Compound Name | (2R,5S)-8-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-[2-[3-(sulfanylmethyl)phenoxy]ethyl]amino]octa-3,6-diene-1,2,3,5,6-pentol |
|---|---|
| PubChem CID | 137448935 |
| Molecular Formula | C23H37NO11S |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | (2R,5S)-8-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-[2-[3-(sulfanylmethyl)phenoxy]ethyl]amino]octa-3,6-diene-1,2,3,5,6-pentol |
| SMILES | OC[C@@H](O)C(O)=C[C@H](O)C(O)=CCN(CCOc1cccc(CS)c1)C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C23H37NO11S/c25-11-20(31)18(29)9-17(28)16(27)4-5-24(10-19(30)22(33)23(34)21(32)12-26)6-7-35-15-3-1-2-14(8-15)13-36/h1-4,8-9,17,19-23,25-34,36H,5-7,10-13H2/t17-,19+,20+,21+,22+,23+/m0/s1 |
| InChIKey | LJYPFSSMYYKDOR-JTDQPSCISA-N |
| XLogP | -2.17 |
| TPSA | 214.77 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|