C28H43NO13S — CID 137448886
S-[[3-[2-[[(2S,3S,4R,6S)-2,3,4,6,7-pentahydroxyheptyl]-[(2S,3S,5S,6R)-2,3,5,6,7-pentahydroxyheptyl]amino]ethoxy]phenyl]methyl] furan-2-carbothioate (PubChem CID 137448886) has the molecular formula C28H43NO13S and a molecular weight of 633.71 g/mol. Its IUPAC name is S-[[3-[2-[[(2S,3S,4R,6S)-2,3,4,6,7-pentahydroxyheptyl]-[(2S,3S,5S,6R)-2,3,5,6,7-pentahydroxyheptyl]amino]ethoxy]phenyl]methyl] furan-2-carbothioate.
| Compound Name | S-[[3-[2-[[(2S,3S,4R,6S)-2,3,4,6,7-pentahydroxyheptyl]-[(2S,3S,5S,6R)-2,3,5,6,7-pentahydroxyheptyl]amino]ethoxy]phenyl]methyl] furan-2-carbothioate |
|---|---|
| PubChem CID | 137448886 |
| Molecular Formula | C28H43NO13S |
| Molecular Weight | 633.71 g/mol |
| Exact Mass | 633.25 |
| IUPAC Name | S-[[3-[2-[[(2S,3S,4R,6S)-2,3,4,6,7-pentahydroxyheptyl]-[(2S,3S,5S,6R)-2,3,5,6,7-pentahydroxyheptyl]amino]ethoxy]phenyl]methyl] furan-2-carbothioate |
| SMILES | O=C(SCc1cccc(OCCN(C[C@H](O)[C@@H](O)[C@H](O)C[C@H](O)CO)C[C@H](O)[C@@H](O)C[C@H](O)[C@H](O)CO)c1)c1ccco1 |
| InChI | InChI=1S/C28H43NO13S/c30-14-18(32)10-22(35)27(39)24(37)13-29(12-23(36)20(33)11-21(34)25(38)15-31)6-8-41-19-4-1-3-17(9-19)16-43-28(40)26-5-2-7-42-26/h1-5,7,9,18,20-25,27,30-39H,6,8,10-16H2/t18-,20-,21-,22+,23-,24-,25+,27-/m0/s1 |
| InChIKey | XXWBAYDCZNUAFR-IPQQPSMXSA-N |
| XLogP | -2.31 |
| TPSA | 244.98 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.71 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|