C26H39NO13S — CID 122440712
3-[[3-[2-[bis[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl]furan-2-carbothioic S-acid (PubChem CID 122440712) has the molecular formula C26H39NO13S and a molecular weight of 605.66 g/mol. Its IUPAC name is 3-[[3-[2-[bis[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl]furan-2-carbothioic S-acid.
| Compound Name | 3-[[3-[2-[bis[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl]furan-2-carbothioic S-acid |
|---|---|
| PubChem CID | 122440712 |
| Molecular Formula | C26H39NO13S |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 3-[[3-[2-[bis[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl]furan-2-carbothioic S-acid |
| SMILES | O=C(S)c1occc1Cc1cccc(OCCN(C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1 |
| InChI | InChI=1S/C26H39NO13S/c28-12-19(32)23(36)21(34)17(30)10-27(11-18(31)22(35)24(37)20(33)13-29)5-7-39-16-3-1-2-14(9-16)8-15-4-6-40-25(15)26(38)41/h1-4,6,9,17-24,28-37H,5,7-8,10-13H2,(H,38,41)/t17-,18-,19-,20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | KKBBEXVUBWRXHB-SMQFSXJJSA-N |
| XLogP | -3.51 |
| TPSA | 244.98 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|