C24H37NO12S — CID 137448942
S-[[3-[2-[[(1Z,3E,5R)-2,3,4,5,6-pentahydroxyhexa-1,3-dienyl]-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] propanethioate (PubChem CID 137448942) has the molecular formula C24H37NO12S and a molecular weight of 563.62 g/mol. Its IUPAC name is S-[[3-[2-[[(1Z,3E,5R)-2,3,4,5,6-pentahydroxyhexa-1,3-dienyl]-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] propanethioate.
| Compound Name | S-[[3-[2-[[(1Z,3E,5R)-2,3,4,5,6-pentahydroxyhexa-1,3-dienyl]-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] propanethioate |
|---|---|
| PubChem CID | 137448942 |
| Molecular Formula | C24H37NO12S |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | S-[[3-[2-[[(1Z,3E,5R)-2,3,4,5,6-pentahydroxyhexa-1,3-dienyl]-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] propanethioate |
| SMILES | CCC(=O)SCc1cccc(OCCN(/C=C(O)/C(O)=C(\O)[C@H](O)CO)C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1 |
| InChI | InChI=1S/C24H37NO12S/c1-2-20(32)38-13-14-4-3-5-15(8-14)37-7-6-25(9-16(28)21(33)23(35)18(30)11-26)10-17(29)22(34)24(36)19(31)12-27/h3-5,8-9,17-19,22,24,26-31,33-36H,2,6-7,10-13H2,1H3/b16-9-,23-21+/t17-,18-,19-,22-,24-/m1/s1 |
| InChIKey | MXIBISDSWXKZGN-ZNHROYDUSA-N |
| XLogP | -0.95 |
| TPSA | 231.84 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|