C12H18ClNO2S — CID 122440745
S-[[3-(2-aminoethoxy)phenyl]methyl] propanethioate;hydrochloride (PubChem CID 122440745) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is S-[[3-(2-aminoethoxy)phenyl]methyl] propanethioate;hydrochloride.
| Compound Name | S-[[3-(2-aminoethoxy)phenyl]methyl] propanethioate;hydrochloride |
|---|---|
| PubChem CID | 122440745 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | S-[[3-(2-aminoethoxy)phenyl]methyl] propanethioate;hydrochloride |
| SMILES | CCC(=O)SCc1cccc(OCCN)c1.Cl |
| InChI | InChI=1S/C12H17NO2S.ClH/c1-2-12(14)16-9-10-4-3-5-11(8-10)15-7-6-13;/h3-5,8H,2,6-7,9,13H2,1H3;1H |
| InChIKey | OTGAPHOYAKBHGD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|